A6812412
Pramipexole 2HCl Monohydrate , ≥98%(HPLC) , 191217-81-9
CAS NO.:191217-81-9
Empirical Formula: C10H20ClN3OS
Molecular Weight: 265.8
MDL number: MFCD00876894
EINECS: 687-708-9
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB51.20 | In Stock |
|
| 250MG | RMB136.80 | In Stock |
|
| 1G | RMB295.20 | In Stock |
|
| 5g | RMB716.00 | In Stock |
|
| 25g | RMB1684.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 290 °C(dec.) |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water, soluble in methanol, sparingly soluble or slightly soluble in ethanol (96 per cent), practically insoluble in methylene chloride. |
| form | Solid |
| color | White to Almost white |
| optical activity | Consistent with structure |
| Merck | 14,7705 |
| BCS Class | 1 |
| InChI | InChI=1/C10H17N3S.ClH.H2O/c1-2-5-12-7-3-4-8-9(6-7)14-10(11)13-8;;/h7,12H,2-6H2,1H3,(H2,11,13);1H;1H2/t7-;;/s3 |
| InChIKey | ZTZQAWQFTIVKMU-DCFBZVEJNA-N |
| SMILES | NC1SC2C[C@@H](NCCC)CCC=2N=1.Cl.O |&1:5,r| |
Description and Uses
Pramipexole dihydrochloride monohydrate is an activator of D2DR, D3DR and D4DR. Pramipexole has been found to have neuroprotective effects independent of its dopamine receptor agonism. It reduces mitochondrial reactive oxygen species (ROS) production and inhibits the activation of apoptotic pathways.
Pramipexole is a drug used to treat the symptoms of Parkinson's Disease (PD) and a antidepressant. It is a non-ergot dopamine agonist drug that is efficacious in treating various Parkinson's symptoms such as tremor, rigidity, and bradykinesia (slow movement)
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H336 |
| Precautionary statements | P261-P264-P270-P271-P301+P312-P304+P340+P312 |
| WGK Germany | 3 |
| RTECS | DL3375000 |
| HS Code | 2934200000 |







