A6817012
Phospho(enol)pyruvic acid cyclohexylammonium salt , >95.0%(T) , 10526-80-4
Synonym(s):
2-(Phosphonooxy)-2-propenoic acid monopotassium salt
CAS NO.：10526-80-4
Empirical Formula: C6H13N.C3H5O6P
Molecular Weight: 267.22
MDL number: MFCD00036375
EINECS: 234-084-7
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB23.20 | In Stock |
|
| 250MG | RMB32.80 | In Stock |
|
| 1G | RMB102.40 | In Stock |
|
| 5G | RMB336.80 | In Stock |
|
| 25G | RMB1146.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140°C |
| Density | 1.36 g/cm3 |
| storage temp. | -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| color | White to Almost white |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C6H13N.C3H5O6P/c7-6-4-2-1-3-5-6;1-2(3(4)5)9-10(6,7)8/h6H,1-5,7H2;1H2,(H,4,5)(H2,6,7,8) |
| InChIKey | VHFCNZDHPABZJO-UHFFFAOYSA-N |
| SMILES | O(P(O)(=O)O)C(=C)C(=O)O.C1CCCCC1N |
| CAS DataBase Reference | 10526-80-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propenoic acid, 2-(phosphonooxy)-, compd. with cyclohexanamine (1:1) (10526-80-4) |
Description and Uses
Phospho(enol)pyruvic Acid Cyclohexylammonium Salt is a reagent in the general synthesis of ethers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29213000 |
