A6824812
3-Pyridinecarboxamide Oxime , ≥98.0%(HPLC) , 1594-58-7
Synonym(s):
N-Hydroxynicotinamidine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB50.40 | In Stock |
|
| 25g | RMB157.60 | In Stock |
|
| 100g | RMB420.00 | In Stock |
|
| 500g | RMB2096.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-135 °C (lit.) |
| Boiling point: | 278.2±32.0 °C(Predicted) |
| Density | 1.31±0.1 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMF: 25 mg/ml; DMSO: 15 mg/ml; Ethanol: 3 mg/ml; PBS (pH 7.2): 1.5 mg/ml |
| form | powder to crystal |
| pka | 13.22±0.50(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C6H7N3O/c7-6(9-10)5-2-1-3-8-4-5/h1-4,10H,(H2,7,9) |
| InChIKey | AQBMQGDKWIPBRF-UHFFFAOYSA-N |
| SMILES | C1=NC=CC=C1C(NO)=N |
| CAS DataBase Reference | 1594-58-7(CAS DataBase Reference) |
Description and Uses
3-Pyridylamidoxime may be used in the synthesis of 3-(3-pyridyl)-5-trichloromethyl-1,2,4-oxadiazole.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 26-36-37/39-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






