A6829312
4-(p-Acetoxyphenyl)-2-butanone , ≥95.0%(GC) , 3572-06-3
Synonym(s):
4-(3-Oxobutyl)phenyl acetate;4-(4-Acetoxyphenyl)-2-butanone;Cue-lure;Q-lure;raspberry ketone acetate
CAS NO.：3572-06-3
Empirical Formula: C12H14O3
Molecular Weight: 206.24
MDL number: MFCD00008704
EINECS: 222-682-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB46.40 | In Stock |
|
| 100G | RMB116.80 | In Stock |
|
| 500g | RMB408.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 123-124 °C0.2 mm Hg(lit.) |
| Density | 1.099 g/mL at 25 °C(lit.) |
| FEMA | 3652 | 4-(P-ACETOXYPHENYL)-2-BUTANONE |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Colorless to Light yellow |
| Odor | at 100.00 %. berry jam raspberry blueberry |
| Odor Type | berry |
| biological source | synthetic |
| Merck | 14,2616 |
| JECFA Number | 731 |
| BRN | 1961620 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C12H14O3/c1-9(13)3-4-11-5-7-12(8-6-11)15-10(2)14/h5-8H,3-4H2,1-2H3 |
| InChIKey | UMIKWXDGXDJQJK-UHFFFAOYSA-N |
| SMILES | CC(=O)CCc1ccc(OC(C)=O)cc1 |
| LogP | 1.01 |
| CAS DataBase Reference | 3572-06-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(p-Acetoxyphenyl)-2-butanone(3572-06-3) |
| EPA Substance Registry System | 4-(4-(Acetyloxy)phenyl)-2-butanone (3572-06-3) |
Description and Uses
4-(3-Oxobutyl)phenyl acetate was used as attractant for detection programs aimed at melon fly and other cuelure-responding Bactrocera fruit flies.
Safety
| Symbol(GHS) |    GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H402 |
| Precautionary statements | P273-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 2 |
| RTECS | EL8950000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29147000 |
| Storage Class | 10 - Combustible liquids |
| Toxicity | LD50 in rats (mg/kg): 3038 ±1266 orally; in rabbits (mg/kg): >2025 dermally; LC50 (24 hr) in rainbow trout, bluegill sunfish (ppm): 21, 18 (Beroza) |
