PRODUCT Properties
| Melting point: | −30 °C(lit.) |
| Boiling point: | 140-142 °C2 mm Hg(lit.) |
| Density | 1.243 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 213 °F |
| storage temp. | 2-8°C |
| form | liquid |
| Appearance | Light brown to brown Liquid |
| BRN | 1107228 |
| InChI | InChI=1S/C9H8O3S/c1-2-8-12-13(10,11)9-6-4-3-5-7-9/h1,3-7H,8H2 |
| InChIKey | RAGBYXLIHQFIPK-UHFFFAOYSA-N |
| SMILES | C(OS(C1=CC=CC=C1)(=O)=O)C#C |
| CAS DataBase Reference | 6165-75-9(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propyn-1-ol, 1-benzenesulfonate (6165-75-9) |
Description and Uses
Propargyl Benzenesulfonate is a general chemical reagent used in organic syntheses. Used in the manufacture of Omarigliptin, a DPP-4 inhibitor used in the treatment of type-2 diabetes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2905299090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






