A6832712
Z-6-Aminohexanoic acid , ≥98%(HPLC) , 1947-00-8
Synonym(s):
N-Carbobenzoxy-ε-aminocaproic acid
CAS NO.:1947-00-8
Empirical Formula: C14H19NO4
Molecular Weight: 265.3
MDL number: MFCD00004423
EINECS: 217-748-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB194.40 | In Stock |
|
| 100g | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-57 °C(lit.) |
| Boiling point: | 408.52°C (rough estimate) |
| Density | 1.162±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.5110 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.76±0.10(Predicted) |
| color | White to Off-White |
| BRN | 2288508 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H19NO4/c16-13(17)9-5-2-6-10-15-14(18)19-11-12-7-3-1-4-8-12/h1,3-4,7-8H,2,5-6,9-11H2,(H,15,18)(H,16,17) |
| InChIKey | RXQDBVWDABAAHL-UHFFFAOYSA-N |
| SMILES | OC(=O)CCCCCNC(=O)OCc1ccccc1 |
| CAS DataBase Reference | 1947-00-8(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2924.29.7790 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







