A6834312
1-Propyl-1<I>H</I>-pyrazole-4-boronic acid pinacol ester , 97% , 827614-69-7
CAS NO.:827614-69-7
Empirical Formula: C12H21BN2O2
Molecular Weight: 236.12
MDL number: MFCD05663871
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB39.20 | In Stock |
|
| 1G | RMB111.20 | In Stock |
|
| 5G | RMB364.80 | In Stock |
|
| 10g | RMB719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 85-87°C |
| Density | 0.996 g/mL at 25 °C |
| refractive index | n20/D1.476 |
| Flash point: | 43℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 2.11±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C12H21BN2O2/c1-6-7-15-9-10(8-14-15)13-16-11(2,3)12(4,5)17-13/h8-9H,6-7H2,1-5H3 |
| InChIKey | BKLGYJWLZWMIDO-UHFFFAOYSA-N |
| SMILES | N1(CCC)C=C(B2OC(C)(C)C(C)(C)O2)C=N1 |
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-10 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | Ⅲ |
| HS Code | 2933199090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





