A6834412
3-(1-Piperazinyl)-1,2-benzisothiazole , ≥98%(HPLC) , 87691-87-0
Synonym(s):
3-Piperazin-1-yl-benzo[d]isothiazole
CAS NO.:87691-87-0
Empirical Formula: C11H13N3S
Molecular Weight: 219.31
MDL number: MFCD04117970
EINECS: 618-048-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB175.20 | In Stock |
|
| 100G | RMB574.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 89.0 to 93.0 °C |
| Boiling point: | 320.2±35.0 °C(Predicted) |
| Density | 1.256 |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.52±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 4253627 |
| InChI | InChI=1S/C11H13N3S/c1-2-4-10-9(3-1)11(13-15-10)14-7-5-12-6-8-14/h1-4,12H,5-8H2 |
| InChIKey | KRDOFMHJLWKXIU-UHFFFAOYSA-N |
| SMILES | S1C2=C(C=CC=C2)C(N2CCNCC2)=N1 |
| LogP | 2.14 |
| CAS DataBase Reference | 87691-87-0(CAS DataBase Reference) |
Description and Uses
3-(1-Piperazinyl)-1,2-benzisothiazole is a reagent used to synthesize Ziprasidione
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,T |
| Risk Statements | 25-36/38 |
| Safety Statements | 26-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 |





