A6836712
3-Phenoxybenzoic acid , ≥98.0% , 3739-38-6
CAS NO.：3739-38-6
Empirical Formula: C13H10O3
Molecular Weight: 214.22
MDL number: MFCD00002498
EINECS: 223-121-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB66.40 | In Stock |
|
| 25G | RMB271.20 | In Stock |
|
| 100G | RMB1071.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-149 °C (lit.) |
| Boiling point: | 314.35°C (rough estimate) |
| Density | 1.1956 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.95(at 25℃) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | It is soluble in water. |
| BRN | 2105574 |
| InChI | InChI=1S/C13H10O3/c14-13(15)10-5-4-8-12(9-10)16-11-6-2-1-3-7-11/h1-9H,(H,14,15) |
| InChIKey | NXTDJHZGHOFSQG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(OC2=CC=CC=C2)=C1 |
| CAS DataBase Reference | 3739-38-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 3-phenoxy- (3739-38-6) |
Description and Uses
3-Phenoxybenzoic Acid, can be used in the preparation of widely used insecticides, such as Permethrin (P288500). which is a synthetic chemical, used as an insecticide, acaricide, and insect repellent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| RTECS | DH6293500 |
| HazardClass | 9 |
| HS Code | 29189090 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LD50,intraperitoneal,350mg/kg (350mg/kg),Journal of Agricultural and Food Chemistry. Vol. 25, Pg. 9, 1977. |
| Limited Quantities | 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
