A6837212
Phenothrin , ≥99%, the heterogeneous mixture , 26002-80-2
CAS NO.:26002-80-2
Empirical Formula: C23H26O3
Molecular Weight: 350.45
MDL number: MFCD00078716
EINECS: 247-404-5
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB351.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25°C |
| Boiling point: | 444.44°C (rough estimate) |
| Density | d2525 1.06 |
| refractive index | nD25 1.5483 |
| storage temp. | 0-6°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Pale yellow to yellow brown liquid |
| Water Solubility | 2mg/L(30 ºC) |
| BRN | 8788185 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. Light sensitive. |
| Major Application | pharmaceutical |
| InChI | 1S/C23H26O3/c1-16(2)13-20-21(23(20,3)4)22(24)25-15-17-9-8-12-19(14-17)26-18-10-6-5-7-11-18/h5-14,20-21H,15H2,1-4H3 |
| InChIKey | SBNFWQZLDJGRLK-UHFFFAOYSA-N |
| SMILES | C\C(C)=C\C1C(C(=O)OCc2cccc(Oc3ccccc3)c2)C1(C)C |
| CAS DataBase Reference | 26002-80-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenothrin(26002-80-2) |
| EPA Substance Registry System | Phenothrin (26002-80-2) |
Description and Uses
Phenothrin is pale yellow to yellow–brown clear liquid with a faint characteristic odor.
ectoparasiticide
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H410 |
| Precautionary statements | P261-P273-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn,N |
| Risk Statements | 20/21/22-50/53 |
| Safety Statements | 13-60-61-24-23 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| RTECS | GZ1975000 |
| HS Code | 29162090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 26002-80-2(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: >10 g/kg YKYUA637,1481,86 |







