A6840012
Poly(ethylene glycol) bis(carboxymethyl) ether , averageMn600 , 39927-08-7
Synonym(s):
Polyethylene glycol 250 diacid;Polyethylene glycol 600 diacid;Polyethylene glycol diacid 600;Polyglycol 250 diacid;Polyglycol 600 diacid
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB127.20 | In Stock |
|
| 25ml | RMB559.20 | In Stock |
|
| 50ML | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.302 g/mL at 25 °C |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | viscous liquid |
| PH | 2.1 (100g/l, H2O) |
| α-end | carboxylic acid |
| Ω-end | carboxylic acid |
| InChI | InChI=1S/C2H4O3.C2H6O2/c3-1-2(4)5;3-1-2-4/h3H,1H2,(H,4,5);3-4H,1-2H2 |
| InChIKey | SZUIEBOFAKRNDS-UHFFFAOYSA-N |
| SMILES | O([H])C([H])([H])C([H])([H])O[H].O([H])C([H])([H])C(=O)O[H] |
Description and Uses
Poly(ethylene glycol) bis(carboxymethyl) ether is a high molecular weight polyether carboxamide used as an extracellular corrosion inhibitor and fluorescence assay for the detection of polyols in macroscopic samples. It is also used in the synthesis of poly(ethylene glycol) bis(carboxymethyl) ether, also known as PEG bis(carboxymethyl) ether, a polymer of poly(ethylene glycol) (PEG) with carboxylic acid functional groups at the ends of the polymer chain.
Poly(ethylene glycol) bis(carboxymethyl) ether may used as a plasticizer.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-27 |
| RIDADR | UN 1760 8/PG 2 |
| WGK Germany | 1 |
| HS Code | 3907 20 11 |
| Storage Class | 10 - Combustible liquids |
| Toxicity | LD50 orally in Rabbit: > 2000 mg/kg |




![Tris(2,2,6,6-tetramethyl-3,5-heptanedionato)europium(III) [NMR Shift Reagent]](https://img.chemicalbook.com/CAS/GIF/15522-71-1.gif)


