A6842812
Purpurin , ≥85.0%(HPLC) , 81-54-9
Synonym(s):
1,2,4-Trihydroxyanthraquinone;Hydroxylizaric acid;Verantin
CAS NO.:81-54-9
Empirical Formula: C14H8O5
Molecular Weight: 256.21
MDL number: MFCD00001203
EINECS: 201-359-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB135.20 | In Stock |
|
| 5G | RMB271.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 253-256 °C(lit.) |
| Boiling point: | 359.45°C (rough estimate) |
| Density | 1.659 |
| refractive index | 1.4825 (estimate) |
| Flash point: | 113 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 7.05±0.20(Predicted) |
| Colour Index | 58205 |
| form | Powder |
| color | Brown-red to brown |
| Water Solubility | 6.405mg/L(25 ºC) |
| λmax | 515 nm 521 nm (2nd) |
| Merck | 14,7945 |
| BRN | 1887127 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C14H8O5/c15-8-5-9(16)14(19)11-10(8)12(17)6-3-1-2-4-7(6)13(11)18/h1-5,15-16,19H |
| InChIKey | BBNQQADTFFCFGB-UHFFFAOYSA-N |
| SMILES | Oc1cc(O)c2C(=O)c3ccccc3C(=O)c2c1O |
| LogP | 4.600 (est) |
| CAS DataBase Reference | 81-54-9 |
| EPA Substance Registry System | Purpurin (81-54-9) |
Description and Uses
Purpurin is an anthraquinone derivative and is well known as a colour pigment derived from madder plants. Purpurin was extensively utilized in herbal remedies, in food colouring and dyes for cotton pr inting. Due to the high antioxidant activity exhibited by anthraquinone compounds, purpurin was determined through studies to possess potential radical scavenging effects. Purprin has also been shown to have inhibitory effects towards serine protease.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,C,F |
| Risk Statements | 36/37/38-34-11 |
| Safety Statements | 26-36-45-36/37/39-16 |
| WGK Germany | 3 |
| RTECS | CB8200000 |
| HS Code | 29146990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





