T8215330
Carminic Acid (Natural dye) , 1260-17-9
Synonym(s):
Carminic acid (C.I. 75470);Natural Red 4
CAS NO.:1260-17-9
Empirical Formula: C22H20O13
Molecular Weight: 492.39
MDL number: MFCD00167028
EINECS: 215-023-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB996.00 | In Stock |
|
| 25g | RMB2628.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136 °C |
| Boiling point: | 506.2°C (rough estimate) |
| alpha | 15654 +51.6° (water) |
| Density | 1.4504 (rough estimate) |
| bulk density | 490kg/m3 |
| refractive index | 1.6000 (estimate) |
| Flash point: | 12℃ |
| storage temp. | room temp |
| solubility | 30g/l |
| Colour Index | 75470 |
| pka | 1.62±0.20(Predicted) |
| form | Crystalline Powder |
| color | Red to dark red |
| PH | 1.6 (10g/l, H2O, 20℃) |
| Odor | Odorless |
| PH Range | 4.8 - 6.2 |
| optical activity | [α]20/D +3.1°, c = 1 in H2O |
| Water Solubility | 1.298g/L(room temperature) |
| λmax | 495 nm |
| ε(extinction coefficient) | ≥13000 at 222-228 nm in ethanol at 0.03g/L ≥18000 at 275-281nm in ethanol at 0.03g/L |
| Merck | 14,1843 |
| BRN | 71651 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChIKey | DGQLVPJVXFOQEV-JNVSTXMASA-N |
| SMILES | Cc1c(C(O)=O)c(O)cc2C(=O)c3c(O)c(O)c([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(O)c3C(=O)c12 |
| LogP | 1.532 (est) |
| CAS DataBase Reference | 1260-17-9 |
| EPA Substance Registry System | C.I. Natural Red 4 (1260-17-9) |
Description and Uses
Carminic acid (C.I. 75470) For staining nuclei in histological sections. Used to prepare staining solutions.
CAS 1260-17-9, pH 1.6 (10?g/l, H?O, 20?°C).
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| HS Code | 32129000 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 1260-17-9(Hazardous Substances Data) |




