A6843412
Pentafluoroiodobenzene , ≥98.0%(GC) , 827-15-6
CAS NO.:827-15-6
Empirical Formula: C6F5I
Molecular Weight: 293.96
MDL number: MFCD00001032
EINECS: 212-565-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB63.20 | In Stock |
|
| 5G | RMB201.60 | In Stock |
|
| 25G | RMB780.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -29°C |
| Boiling point: | 161 °C(lit.) |
| Density | 2.204 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | None |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Liquid |
| Specific Gravity | 2.204 |
| color | Clear colorless |
| Water Solubility | Insoluble in water. |
| Sensitive | Light Sensitive |
| BRN | 2051549 |
| Exposure limits | ACGIH: TWA 0.2 mg/m3; TWA 1 mg/m3 OSHA: TWA 0.1 mg/m3; TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 1 mg/m3; TWA 0.1 mg/m3 |
| InChI | InChI=1S/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | OPYHNLNYCRZOGY-UHFFFAOYSA-N |
| SMILES | C1(F)=C(I)C(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 827-15-6(CAS DataBase Reference) |
Description and Uses
- Iodopentafluorobenzene was used to study the formation of radical ions of iodopentafluorobenzene in aqueous solution.
- It was used as solvent in a study to determine singlet oxgen lifetimes from phosphorescence decays in halogen substituted perfluorinated solvents by infrared emission spectrometery.
- It has potential applications in plasma processing industry and in preparation of catalysts.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





