A6847812
1-(Phenylsulfonyl)pyrrole , ≥98% , 16851-82-4
CAS NO.：16851-82-4
Empirical Formula: C10H9NO2S
Molecular Weight: 207.25
MDL number: MFCD00067739
EINECS: 623-685-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB47.20 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB206.40 | In Stock |
|
| 100G | RMB784.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-91 °C (lit.) |
| Boiling point: | 368.9±25.0 °C(Predicted) |
| Density | 1.2784 (rough estimate) |
| refractive index | 1.5250 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | -8.50±0.70(Predicted) |
| form | Crystals or Crystalline Powder |
| color | Beige to light brown |
| BRN | 1619427 |
| InChI | InChI=1S/C10H9NO2S/c12-14(13,11-8-4-5-9-11)10-6-2-1-3-7-10/h1-9H |
| InChIKey | PPPXRIUHKCOOMU-UHFFFAOYSA-N |
| SMILES | N1(S(C2=CC=CC=C2)(=O)=O)C=CC=C1 |
| CAS DataBase Reference | 16851-82-4(CAS DataBase Reference) |
Description and Uses
1-(Phenylsulfonyl)pyrrole (1-phenylsulfonyl-1H-pyrrole) may be used in the synthesis of 1-(phenylsulfonyl)pyrrole-2-boronic acid, via lithiation of 1-(phenylsulfonyl)-pyrrole. It may be used for the synthesis of 1-phenylsulfonyl-1H-pyrrole-3-sulfonyl chloride derivatives, which affords sulfonamide derivatives by reaction with nitrogen nucleophiles.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29350090 |
