A6849012
5-(2-Pyridyl)-1H-tetrazole , ≥98% , 33893-89-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB121.60 | In Stock |
|
| 5G | RMB435.20 | In Stock |
|
| 10g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 214-215 |
| Boiling point: | 377.1±34.0 °C(Predicted) |
| Density | 1.388±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 6.66±0.19(Predicted) |
| color | White to Light yellow |
| Water Solubility | Soluble in water at 25°C 11 g/L. |
| InChI | InChI=1S/C6H5N5/c1-2-4-7-5(3-1)6-8-10-11-9-6/h1-4H,(H,8,9,10,11) |
| InChIKey | LQWXEEDCMLEVHU-UHFFFAOYSA-N |
| SMILES | C1(C2=NNN=N2)=NC=CC=C1 |
| CAS DataBase Reference | 33893-89-9(CAS DataBase Reference) |
Description and Uses
It is used in the synthesis and crystal structure of the [Ag(2-allyl-5-phenyl-2Htetrazole)ClO4] π,?-complex .
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H228 |
| Precautionary statements | P240-P210-P241-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-36/37/39-36-39 |
| RIDADR | NA3077 |
| Hazard Note | Harmful |
| HS Code | 2933.99.8290 |
| HazardClass | IRRITANT-HARMFUL |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Non-Hazardous |
