A6863212
Pyrimethamine , 98% , 58-14-0
Synonym(s):
5-(4-Chlorophenyl)-6-ethyl-2,4-pyrimidinediamine;Pyrimethamine
CAS NO.:58-14-0
Empirical Formula: C12H13ClN4
Molecular Weight: 248.71
MDL number: MFCD00057350
EINECS: 200-364-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB45.60 | In Stock |
|
| 25G | RMB149.60 | In Stock |
|
| 100g | RMB400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 233-234°C |
| Boiling point: | 393.35°C (rough estimate) |
| Density | 1.2171 (rough estimate) |
| refractive index | 1.6110 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Prepare the solution immediately before use. Dissolve 0.25 g in a mixture of 1 volume of methanol R and 3 volumes of methylene chloride R and dilute to 10 mL with the same mixture of solvents. The solution is clear (2.2.1) and not more intensely coloured than reference solution BY6 (2.2.2, Method II). |
| form | Solid |
| pka | pKa 7(t=20.0) (Uncertain) |
| color | White to Off-White |
| Water Solubility | <0.01 g/100 mL at 21 ºC |
| λmax | 276nm(lit.) |
| Merck | 14,7985 |
| BRN | 219864 |
| BCS Class | 2 (CLogP), 4
(LogP),3 |
| Stability: | Stable, but light sensitive. Combustible. Incompatible with strong oxidizing agents. |
| Major Application | clinical testing |
| InChI | 1S/C12H13ClN4/c1-2-9-10(11(14)17-12(15)16-9)7-3-5-8(13)6-4-7/h3-6H,2H2,1H3,(H4,14,15,16,17) |
| InChIKey | WKSAUQYGYAYLPV-UHFFFAOYSA-N |
| SMILES | CCC1=NC(N)=NC(N)=C1C2=CC=C(Cl)C=C2 |
| CAS DataBase Reference | 58-14-0(CAS DataBase Reference) |
| IARC | 3 (Vol. 13, Sup 7) 1987 |
| NIST Chemistry Reference | Pyrimethamine(58-14-0) |
| EPA Substance Registry System | Pyrimethamine (58-14-0) |
Description and Uses
Dihydrofolate reductase inhibitor; generally used in combination with other antimicrobial agents. Antiprotozoal (Toxoplasma); antimalarial
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | UV8140000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 58-14-0(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 440mg/kg |




