A6868212
2-Pyridyl Trifluoromethanesulfonate , >98.0%(GC) , 65007-00-3
Synonym(s):
2-Pyridyl triflate
| Pack Size | Price | Stock | Quantity |
| 1G | RMB188.00 | In Stock |
|
| 5G | RMB537.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 108 °C/25 mmHg (lit.) |
| Density | 1.477 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 80 °F |
| form | Liquid |
| pka | -1.98±0.19(Predicted) |
| color | Colorless to orange |
| InChI | 1S/C6H4F3NO3S/c7-6(8,9)14(11,12)13-5-3-1-2-4-10-5/h1-4H |
| InChIKey | COLRMVLTWJTLFJ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)S(=O)(=O)Oc1ccccn1 |
Description and Uses
2-Pyridyl trifluoromethanesulfonate (2-Pyridyl triflate) may be used in the preparation of pyridinium salts [R-iso-BIPY-H]+[OTF]- salts (R-iso-BIPY = N-(2-pyridyl)-R-pyridine-2-ylidene [R = 4-H, 4-tert-butyl, 4-dimethylamino, 5-dimethylamino]; OTf- = trifluoromethanesulfonate).
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P303+P361+P353-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







