A6870112
<i>p</i>-Xylyl Cyanide , >98.0%(GC) , 2947-61-7
Synonym(s):
α-Cyano-p-xylene;p-Tolylacetonitrile;4-Methylbenzyl cyanide;4-Methylphenylacetonitrile
CAS NO.:2947-61-7
Empirical Formula: C9H9N
Molecular Weight: 131.17
MDL number: MFCD00001922
EINECS: 220-963-2
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB35.20 | In Stock |
|
| 25ML | RMB74.40 | In Stock |
|
| 500ML | RMB79.20 | In Stock |
|
| 100ML | RMB211.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 18 °C(lit.) |
| Boiling point: | 242-243 °C(lit.) |
| Density | 0.992 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 223 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| Specific Gravity | 0.99 |
| color | Clear colorless to faintly yellow |
| BRN | 1099645 |
| Exposure limits | NIOSH: IDLH 25 mg/m3 |
| InChI | InChI=1S/C9H9N/c1-8-2-4-9(5-3-8)6-7-10/h2-5H,6H2,1H3 |
| InChIKey | RNHKXHKUKJXLAU-UHFFFAOYSA-N |
| SMILES | C1(CC#N)=CC=C(C)C=C1 |
| CAS DataBase Reference | 2947-61-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneacetonitrile, 4-methyl-(2947-61-7) |
Description and Uses
4-Methylbenzyl cyanide is used as an intermediate in fragrances, dyes and pharmaceuticals.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS07 |
| Signal word | Warning |
| Hazard statements | H412 |
| Precautionary statements | P273-P501 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37-24/25 |
| RIDADR | UN 3276 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 3 |







