A6871712
1-Phenylcyclopropanecarbonitrile , >98.0%(GC) , 935-44-4
CAS NO.：935-44-4
Empirical Formula: C10H9N
Molecular Weight: 143.19
MDL number: MFCD00001270
EINECS: 213-304-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB31.20 | In Stock |
|
| 1G | RMB51.20 | In Stock |
|
| 5G | RMB174.40 | In Stock |
|
| 25G | RMB620.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 133-137 °C30 mm Hg(lit.) |
| Density | 1 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.000 |
| color | Clear colorless to slightly yellow |
| InChI | InChI=1S/C10H9N/c11-8-10(6-7-10)9-4-2-1-3-5-9/h1-5H,6-7H2 |
| InChIKey | ZHFURHRJUWYDKG-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)(C#N)CC1 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | UN3276 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 29269095 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
