A6872912
<i>p</i>-Toluenesulfonic Anhydride , >95.0%(T) , 4124-41-8
CAS NO.:4124-41-8
Empirical Formula: C14H14O5S2
Molecular Weight: 326.38
MDL number: MFCD00008548
EINECS: 223-926-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB59.20 | In Stock |
|
| 100G | RMB219.20 | In Stock |
|
| 500g | RMB988.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-127 °C(lit.) |
| Boiling point: | 478.0±48.0 °C(Predicted) |
| Density | 1.361±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| form | Powder, Crystals and/or Chunks |
| color | Off-white to gray |
| Sensitive | Moisture Sensitive |
| BRN | 2223702 |
| InChI | 1S/C14H14O5S2/c1-11-3-7-13(8-4-11)20(15,16)19-21(17,18)14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| InChIKey | PDVFSPNIEOYOQL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)S(=O)(=O)OS(=O)(=O)c2ccc(C)cc2 |
| CAS DataBase Reference | 4124-41-8(CAS DataBase Reference) |
Description and Uses
p-Toluenesulfonic anhydride has been employed as reagent in palladium-catalyzed allylic alkenylation of allylic alcohols with n-butyl acrylate.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2585 8/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29041000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |





