A6873512
Phenylsulfonylacetonitrile , 98% , 7605-28-9
CAS NO.：7605-28-9
Empirical Formula: C8H7NO2S
Molecular Weight: 181.21
MDL number: MFCD00007550
EINECS: 231-515-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB36.00 | In Stock |
|
| 5G | RMB133.60 | In Stock |
|
| 25G | RMB477.60 | In Stock |
|
| 100G | RMB1429.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-114 °C(lit.) |
| Boiling point: | 398.5±34.0 °C(Predicted) |
| Density | 1.284±0.06 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.5650 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 640716 |
| InChI | InChI=1S/C8H7NO2S/c9-6-7-12(10,11)8-4-2-1-3-5-8/h1-5H,7H2 |
| InChIKey | ZFCFFNGBCVAUDE-UHFFFAOYSA-N |
| SMILES | C(#N)CS(C1=CC=CC=C1)(=O)=O |
| CAS DataBase Reference | 7605-28-9(CAS DataBase Reference) |
Description and Uses
(Phenylsulfonyl)acetonitrile was used in the synthesis of pyridines, chromenes and thiophene derivatives based on sulfones.
Safety
| Symbol(GHS) |  GHS06,GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H301+H311+H331 |
| Precautionary statements | P261-P264-P280-P261-P264-P280-P301+P310-P302+P352+P312-P304+P340+P311-P301+P310-P302+P352+P312-P304+P340+P311 |
| Hazard Codes | T,Xi |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 36/37/39-45-36-26 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2930909899 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
