A6874912
Pentachloroaniline , >97.0%(GC) , 527-20-8
CAS NO.:527-20-8
Empirical Formula: C6H2Cl5N
Molecular Weight: 265.35
MDL number: MFCD00014769
EINECS: 208-410-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB67.20 | In Stock |
|
| 5G | RMB332.00 | In Stock |
|
| 25g | RMB1396.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232 °C |
| Boiling point: | 335.8±37.0 °C(Predicted) |
| Density | 1.751±0.06 g/cm3(Predicted) |
| Flash point: | 100 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | -2.04±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Sensitive | Air & Light Sensitive |
| BRN | 2806732 |
| Stability: | Hygroscopic |
| Major Application | agriculture environmental |
| InChI | 1S/C6H2Cl5N/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H2 |
| InChIKey | KHCZSJXTDDHLGJ-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| CAS DataBase Reference | 527-20-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Pentachloroaniline(527-20-8) |
| EPA Substance Registry System | Benzenamine, 2,3,4,5,6-pentachloro- (527-20-8) |
Description and Uses
2,3,4,5,6-Pentachlorobenzeneamine is a chemical in pesticides used to protect crops from various fungus and bacterium.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H373-H410 |
| Precautionary statements | P273-P280-P301+P310-P302+P352+P312-P304+P340+P311-P314 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Statements | 20/21/22-36/37/38-23/24/25-33-50/53 |
| Safety Statements | 26-36/37/39-45-22-36/37-61-60-28 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | BY7910000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| Hazardous Substances Data | 527-20-8(Hazardous Substances Data) |







