A6880912
1-(<i>p</i>-Tolyl)ethylamine , >96.0%(GC)(T) , 586-70-9
CAS NO.：586-70-9
Empirical Formula: C9H13N
Molecular Weight: 135.21
MDL number: MFCD00041137
EINECS: 443-160-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB90.40 | In Stock |
|
| 5G | RMB287.20 | In Stock |
|
| 25g | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 211-212 °C (lit.) |
| Density | 0.926 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 178 °F |
| storage temp. | 2-8°C, protect from light |
| form | clear liquid |
| pka | 9.20±0.10(Predicted) |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C9H13N/c1-7-3-5-9(6-4-7)8(2)10/h3-6,8H,10H2,1-2H3 |
| InChIKey | UZDDXUMOXKDXNE-UHFFFAOYSA-N |
| SMILES | C1(C=CC(C)=CC=1)C(N)C |
Description and Uses
1-(4-Methylphenyl)ethylamine (1-p-tolylethanamine) may be used in the preparation of 1,1′-(2-thienylmethylene) di-2-naphthol ethyl acetate solvate and (R)-N-(1-p-tolylethyl)-2-methoxyacetamide.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H317 |
| Precautionary statements | P261-P272-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 2 |
| HS Code | 2921.49.5000 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
