A6883012
6-Phenylhexanoic Acid , >98.0%(GC) , 5581-75-9
Synonym(s):
Benzenehexanoic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB239.20 | In Stock |
|
| 5G | RMB799.20 | In Stock |
|
| 25G | RMB2631.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 17-19°C |
| Boiling point: | 201-202 °C24 mm Hg(lit.) |
| Density | 1.022 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store at room temperature |
| solubility | Difficult to mix. |
| pka | 4.78±0.10(Predicted) |
| form | Solid |
| color | White |
| Water Solubility | 479.8mg/L(30 ºC) |
| BRN | 1950106 |
| InChI | InChI=1S/C12H16O2/c13-12(14)10-6-2-5-9-11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H,13,14) |
| InChIKey | JTXZPQIXIXYMDY-UHFFFAOYSA-N |
| SMILES | C1(CCCCCC(O)=O)=CC=CC=C1 |
| CAS DataBase Reference | 5581-75-9(CAS DataBase Reference) |
Description and Uses
6-Phenylhexanoic Acid (cas# 5581-75-9) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![5-(2,5-Dioxotetrahydrofuran-3-yl)-4,5-dihydronaphtho[1,2-c]furan-1,3(3aH,9bH)-dione](https://img.chemicalbook.com/CAS/GIF/13912-65-7.gif)


