A6886112
(±)-6,6'-Dibromo-1,1'-bi-2-naphthol , >98.0%(HPLC) , 13185-00-7
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB97.60 | In Stock |
|
| 1G | RMB323.68 | In Stock |
|
| 5G | RMB971.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 195-199 °C(lit.) |
| Boiling point: | 546.2±45.0 °C(Predicted) |
| Density | 1.761 |
| refractive index | 1.4947 (estimate) |
| storage temp. | 2-8°C |
| pka | 7.78±0.50(Predicted) |
| form | Powder |
| color | white |
| optical activity | -0.64°(C=1g/100ml CHCL3) |
| InChI | 1S/C20H12Br2O2/c21-13-3-5-15-11(9-13)1-7-17(23)19(15)20-16-6-4-14(22)10-12(16)2-8-18(20)24/h1-10,23-24H |
| InChIKey | OORIFUHRGQKYEV-UHFFFAOYSA-N |
| SMILES | Oc1ccc2cc(Br)ccc2c1-c3c(O)ccc4cc(Br)ccc34 |
| CAS DataBase Reference | 13185-00-7(CAS DataBase Reference) |
Description and Uses
6,6′-Dibromo-1,1′-bi-2-naphthol is a 1,1′-bi-2-naphthol derivative. Vibrational circular dichroism (VCD), electronic circular dichroism (ECD) and optical rotatory dispersion (ORD) spectra for the enantiomers of 6,6′-dibromo-1,1′-bi-2-naphthol have been evaluated.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29072900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
