A6893212
1-Phenyl-1-trimethylsilyloxyethylene , >95.0%(GC) , 13735-81-4
Synonym(s):
α-(Trimethylsiloxy)styrene;Acetophenone enol trimethylsilyl ether
CAS NO.:13735-81-4
Empirical Formula: C11H16OSi
Molecular Weight: 192.33
MDL number: MFCD00008582
EINECS: 237-308-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB58.40 | In Stock |
|
| 5G | RMB203.20 | In Stock |
|
| 25G | RMB559.20 | In Stock |
|
| 100G | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 122-123 °C |
| Boiling point: | 88-89 °C/11 mmHg (lit.) |
| Density | 0.938 g/mL at 25 °C (lit.) |
| vapor density | >1 (vs air) |
| refractive index | n |
| Flash point: | 174 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 0.938 |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1306914 |
| InChI | 1S/C11H16OSi/c1-10(12-13(2,3)4)11-8-6-5-7-9-11/h5-9H,1H2,2-4H3 |
| InChIKey | AFFPCIMDERUIST-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC(=C)c1ccccc1 |
| CAS DataBase Reference | 13735-81-4(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, trimethyl[(1-phenylethenyl)oxy]- (13735-81-4) |
Description and Uses
1-Phenyl-1-trimethylsiloxyethylene has been used in the synthesis of β-amino ketones in water via Mannich-type reaction and cis-2,6-disubstituted dihydropyrans via three-component, one-pot cascade reaction. It is also used as chemical additives and intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 2931900090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





