A6901812
2,3,4,5,6-Pentafluorostyrene (stabilized with TBC) , >98.0%(GC) , 653-34-9
Synonym(s):
(Perfluorophenyl)ethylene;1,2,3,4,5-Pentafluoro-6-vinylbenzene;Ethenylpentafluorobenzene
CAS NO.:653-34-9
Empirical Formula: C8H3F5
Molecular Weight: 194.1
MDL number: MFCD00000300
EINECS: 211-500-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB65.60 | In Stock |
|
| 5G | RMB249.60 | In Stock |
|
| 25G | RMB1064.00 | In Stock |
|
| 100G | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 62-63 °C/50 mmHg (lit.) |
| Density | 1.406 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 94 °F |
| storage temp. | -20°C |
| form | Liquid |
| Specific Gravity | 1.432 |
| color | Clear colorless to yellow |
| Water Solubility | Immiscible with water. |
| BRN | 1874390 |
| Stability: | Flammable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C8H3F5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H,1H2 |
| InChIKey | LVJZCPNIJXVIAT-UHFFFAOYSA-N |
| SMILES | C1(C=C)=C(F)C(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 653-34-9(CAS DataBase Reference) |
Description and Uses
2,3,4,5,6-Pentafluorostyrene is used in the synthesis of optically active copolymers having low surface energies by utilizing beta-pinene as another monomer. It is also used in the synthesis of fluorinated and photo crosslinkable liquid prepolymers, which is used for flexible optical waveguides. Polymeric fluorinated nano particles prepared using 2,3,4,5,6-Pentafluorostyrene and styrene is explored in magnetic resonance image (MRI) applications, since it has larger structural design potential compared to traditional systems like emulsions and solutions of smaller molecules.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F |
| Risk Statements | 10 |
| Safety Statements | 23-24/25-16 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Keep Cold |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





