A6906512
4-(Phenylazo)diphenylamine , >97% , 101-75-7
Synonym(s):
N-Phenyl-4-phenylazoaniline;4-Anilinoazobenzene
CAS NO.:101-75-7
Empirical Formula: C18H15N3
Molecular Weight: 273.33
MDL number: MFCD00003023
EINECS: 202-972-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB71.20 | In Stock |
|
| 5G | RMB239.20 | In Stock |
|
| 25G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-91 °C |
| Boiling point: | 406.35°C (rough estimate) |
| Density | 1.0332 (rough estimate) |
| refractive index | 1.5480 (estimate) |
| storage temp. | room temp |
| solubility | Solubility Insoluble in water; soluble in ethanol, methanol |
| pka | 0.42(at 25℃) |
| form | Fine Crystalline Powder |
| color | Orange |
| PH Range | Red (1.2) to yellow (2.5) |
| λmax | 411nm, 272nm |
| BRN | 749359 |
| Major Application | Display device, nonlinear optial (NLO) material, photoresists, printing plates, lithographic plates, photosensitive materials, photography, markers |
| InChI | InChI=1S/C18H15N3/c1-3-7-15(8-4-1)19-16-11-13-18(14-12-16)21-20-17-9-5-2-6-10-17/h1-14,19H |
| InChIKey | VXLFYNFOITWQPM-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC=C(N=NC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 101-75-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, N-phenyl-4-(phenylazo)- (101-75-7) |
Description and Uses
4-(Phenylazo)diphenylamine is a soluble azo dye and stain. Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3234 |
| WGK Germany | 1 |
| RTECS | JK0185000 |
| TSCA | TSCA listed |
| HS Code | 29270000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 ivn-mus: 56 mg/kg CSLNX* NX#03760 |






![5-[(4-anilino-5-sulphonaphthyl)azo]-4-hydroxynaphthalene-2,7-disulphonic acid](https://img.chemicalbook.com/CAS/GIF/7488-76-8.gif)
