LN3749146
DisperseOrange1 , Analysis standard reagent , 2581-69-3
Synonym(s):
4-(4-Nitrophenylazo)diphenylamine
CAS NO.:2581-69-3
Empirical Formula: C18H14N4O2
Molecular Weight: 318.33
MDL number: MFCD00007311
EINECS: 219-954-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1066.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160 °C |
| Boiling point: | 457.5°C (rough estimate) |
| Density | 1.2846 (rough estimate) |
| refractive index | 1.6700 (estimate) |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Sonicated) |
| pka | -0.60±0.40(Predicted) |
| form | Solid |
| Colour Index | 11080 |
| color | Dark Purple to Very Dark Purple |
| Water Solubility | 0.4775ug/L(25 ºC) |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | InChI=1S/C18H14N4O2/c23-22(24)18-12-10-17(11-13-18)21-20-16-8-6-15(7-9-16)19-14-4-2-1-3-5-14/h1-13,19H |
| InChIKey | YFVXLROHJBSEDW-UHFFFAOYSA-N |
| SMILES | C1(NC2=CC=CC=C2)=CC=C(N=NC2=CC=C([N+]([O-])=O)C=C2)C=C1 |
| EPA Substance Registry System | Benzenamine, 4-[(4-nitrophenyl)azo]-N-phenyl- (2581-69-3) |
Description and Uses
Disperse Orange 1 is an azo disperse dye which is water insoluble. Disperse Orange 1 can be used to dye polyester and acetate fibers. Dyes and metabolites, Environmental Testing.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| RTECS | JJ9700000 |
| F | 10-21 |
| TSCA | TSCA listed |
| HS Code | 32041100 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 2581-69-3(Hazardous Substances Data) |






