A6915712
Pentafluorobenzoic Acid , >98.0%(GC) , 602-94-8
CAS NO.:602-94-8
Empirical Formula: C7HF5O2
Molecular Weight: 212.07
MDL number: MFCD00002406
EINECS: 210-026-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB48.00 | In Stock |
|
| 100G | RMB172.80 | In Stock |
|
| 500G | RMB780.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-102 °C (lit.) |
| Boiling point: | 220 °C (lit.) |
| Density | 1,944 g/cm3 |
| Flash point: | 219-221°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| pka | 1.75(at 25℃) |
| form | crystal |
| color | white |
| BRN | 2054395 |
| InChI | InChI=1S/C7HF5O2/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h(H,13,14) |
| InChIKey | YZERDTREOUSUHF-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(F)C(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 602-94-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, pentafluoro-(602-94-8) |
| EPA Substance Registry System | Benzoic acid, pentafluoro- (602-94-8) |
Description and Uses
Pentafluorobenzoic acid serves as a precursor in the development of antibacterial and antimicrobial drugs such as sparfloxacin and rufloxacin[1]. It acts as a reagent for synthesizing 1H,1H,7H-dodecafluoroheptyl pentafluorobenzoate from 1H,1H,7H-dodecafluoro-1-heptanol, utilizing DMAP and EDCI in dichloromethane at room temperature[2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38 |
| Safety Statements | 26-45-36/37/39-24/25 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DH6195000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 ipr-mus: 178 mg/kg JMCMAR 11,1020,68 |







