A6918512
(+)-Pulegone , >85.0%(GC) , 89-82-7
Synonym(s):
(+)-Pulegone;(R)-(+)-Pulegone;p-Menth-4(8)-en-3-one;(R)-p-Menth-4(8)-en-3-one;(R)-2-Isopropylidene-5-methylcyclohexanone
CAS NO.：89-82-7
Empirical Formula: C10H16O
Molecular Weight: 152.23
MDL number: MFCD00063000
EINECS: 201-943-2
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB77.60 | In Stock |
|
| 5ML | RMB183.20 | In Stock |
|
| 25ML | RMB639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <=25°C |
| alpha | D20 +21°; 20546 +28.2° |
| Boiling point: | 224 °C(lit.) |
| Density | 0.937 g/mL at 25 °C(lit.) |
| vapor pressure | 138 mm Hg ( 25 °C) |
| refractive index | n |
| FEMA | 2963 | PULEGONE |
| Flash point: | 185 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 0.94 |
| Odor | at 100.00 %. peppermint camphor fresh herbal buchu |
| Odor Type | minty |
| optical activity | [α]20/D +23.5°, neat |
| biological source | synthetic |
| λmax | 255nm(lit.) |
| Merck | 14,7937 |
| JECFA Number | 753 |
| BRN | 2040703 |
| Dielectric constant | 9.5（20℃） |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h8H,4-6H2,1-3H3/t8-/m1/s1 |
| InChIKey | NZGWDASTMWDZIW-MRVPVSSYSA-N |
| SMILES | C[C@@H]1CC\C(=C(\C)C)C(=O)C1 |
| LogP | 2.56 |
| CAS DataBase Reference | 89-82-7(CAS DataBase Reference) |
| IARC | 2B (Vol. 108) 2016 |
| EPA Substance Registry System | d-Pulegone (89-82-7) |
Description and Uses
A monoterpene, commonly found in the essential oils of Nepeta cataria (Catnip).
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H351 |
| Precautionary statements | P202-P264-P270-P280-P301+P312-P308+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 23-24/25 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | OT0261000 |
| F | 10-23 |
| TSCA | TSCA listed |
| HS Code | 2914 29 00 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 |
| Hazardous Substances Data | 89-82-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 470 mg/kg LD50 dermal Rabbit 3090 mg/kg |
| Excepted Quantities | Non-Hazardous |
