A6920512
1-Phenylisatin , >98.0%(GC) , 723-89-7
Synonym(s):
1-Phenyl-2,3-indolinedione;NSC 100013
CAS NO.:723-89-7
Empirical Formula: C14H9NO2
Molecular Weight: 223.23
MDL number: MFCD00082681
EINECS: 624-596-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB113.60 | In Stock |
|
| 5G | RMB415.20 | In Stock |
|
| 25G | RMB1463.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-140 °C (lit.) |
| Boiling point: | 388.8±25.0 °C(Predicted) |
| Density | 1.338±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -7.03±0.20(Predicted) |
| color | Light yellow to Brown |
| Water Solubility | Insoluble in water. |
| λmax | 419nm(EtOH)(lit.) |
| BRN | 164531 |
| InChI | InChI=1S/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
| InChIKey | UWCPWBIMRYXUOU-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC=C2)C2=C(C=CC=C2)C(=O)C1=O |
| CAS DataBase Reference | 723-89-7(CAS DataBase Reference) |
Description and Uses
1-Phenylisatin is a reactant for preparation of indolin-2,3-dione Schiff bases as potential antimycobacterial agents, antipyretic agents, antiproliferative agents, phenylacetamides as anticonvulsant agents and selective Galanin GAL3 receptor antagonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24/25 |
| Safety Statements | 27-28-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | NL7984000 |
| HazardClass | IRRITANT |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






