A6922312
1-Phenyl-2-(trimethylsilyl)acetylene , >98.0%(GC) , 2170-06-1
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB95.20 | In Stock |
|
| 25ML | RMB428.80 | In Stock |
|
| 100ML | RMB1572.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 87-88 °C9 mm Hg(lit.) |
| Density | 0.886 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 165 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Sparingly Soluble (6.1E-3 g/L) (25°C) |
| form | Liquid |
| color | Colorless |
| Specific Gravity | 0.886 |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 3088678 |
| InChI | InChI=1S/C11H14Si/c1-12(2,3)10-9-11-7-5-4-6-8-11/h4-8H,1-3H3 |
| InChIKey | UZIXCCMXZQWTPB-UHFFFAOYSA-N |
| SMILES | C1(C#C[Si](C)(C)C)=CC=CC=C1 |
| CAS DataBase Reference | 2170-06-1(CAS DataBase Reference) |
Description and Uses
1-Phenyl-2-trimethylsilylacetylene was used in the preparation of donor-stabilized Pt-η2-alkyne complexes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| F | 8 |
| TSCA | No |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![4-[(Trimethylsilyl)ethynyl]benzaldehyde](https://img.chemicalbook.com/CAS/GIF/77123-57-0.gif)
