A6922312
                    1-Phenyl-2-(trimethylsilyl)acetylene , >98.0%(GC) , 2170-06-1
| Pack Size | Price | Stock | Quantity | 
| 5ML | RMB95.20 | In Stock | 
                                                 | 
                                        
| 25ML | RMB428.80 | In Stock | 
                                                 | 
                                        
| 100ML | RMB1572.80 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 87-88 °C9 mm Hg(lit.) | 
                                    
| Density | 0.886 g/mL at 25 °C(lit.) | 
                                    
| refractive index | n | 
                                    
| Flash point: | 165 °F | 
                                    
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature | 
                                    
| solubility | Sparingly Soluble (6.1E-3 g/L) (25°C) | 
                                    
| form | Liquid | 
                                    
| color | Colorless | 
                                    
| Specific Gravity | 0.886 | 
                                    
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems | 
                                    
| BRN | 3088678 | 
                                    
| InChI | InChI=1S/C11H14Si/c1-12(2,3)10-9-11-7-5-4-6-8-11/h4-8H,1-3H3 | 
                                    
| InChIKey | UZIXCCMXZQWTPB-UHFFFAOYSA-N | 
                                    
| SMILES | C1(C#C[Si](C)(C)C)=CC=CC=C1 | 
                                    
| CAS DataBase Reference | 2170-06-1(CAS DataBase Reference) | 
                                    
Description and Uses
1-Phenyl-2-trimethylsilylacetylene was used in the preparation of donor-stabilized Pt-η2-alkyne complexes.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36/37/39 | 
| RIDADR | NA 1993 / PGIII | 
| WGK Germany | 3 | 
| F | 8 | 
| TSCA | No | 
| HS Code | 29319090 | 






![4-[(Trimethylsilyl)ethynyl]benzaldehyde](https://img.chemicalbook.com/CAS/GIF/77123-57-0.gif)
