A8213612
4-[(Trimethylsilyl)ethynyl]benzaldehyde , 97% , 77123-57-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB150.40 | In Stock |
|
| 25G | RMB575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-70 °C(lit.) |
| Boiling point: | 262.1±32.0 °C(Predicted) |
| Density | 0.98±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| Appearance | Light brown to brown Solid |
| InChI | 1S/C12H14OSi/c1-14(2,3)9-8-11-4-6-12(10-13)7-5-11/h4-7,10H,1-3H3 |
| InChIKey | UZQDUXAJFTWMDT-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#Cc1ccc(C=O)cc1 |
Description and Uses
4-(Trimethylsilyl)ethynylbenzaldehyde is a useful reactant for the synthesis of acetylene-substituted naphthalene diimides in polar solvents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | T |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |

![4-[(Trimethylsilyl)ethynyl]benzaldehyde](https://img.chemicalbook.com/CAS/GIF/77123-57-0.gif)




