A7689712
4-(Trifluoromethyl)benzaldehyde , 97% , 455-19-6
Synonym(s):
α,α,α-Trifluoro-p-tolualdehyde
CAS NO.:455-19-6
Empirical Formula: C8H5F3O
Molecular Weight: 174.12
MDL number: MFCD00006952
EINECS: 207-240-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB60.00 | In Stock |
|
| 100G | RMB170.40 | In Stock |
|
| 500g | RMB732.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 1-2°C |
| Boiling point: | 66-67 °C13 mm Hg(lit.) |
| Density | 1.275 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 150 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | 1.5g/l |
| form | Liquid |
| Specific Gravity | 1.275 |
| color | Clear colorless to yellow |
| Water Solubility | Soluble in water. 1.5 g/L at 20°C |
| Sensitive | Air Sensitive |
| BRN | 1101680 |
| InChI | 1S/C8H5F3O/c9-8(10,11)7-3-1-6(5-12)2-4-7/h1-5H |
| InChIKey | BEOBZEOPTQQELP-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(cc1)C(F)(F)F |
| CAS DataBase Reference | 455-19-6(CAS DataBase Reference) |
| NIST Chemistry Reference | p-CF3C6H4CHO(455-19-6) |
| EPA Substance Registry System | Benzaldehyde, 4-(trifluoromethyl)- (455-19-6) |
Description and Uses
4-(Trifluoromethyl)benzaldehyde is a reactant that has been used in the preparation of N,N''-(Arylmethylene)bisamides with cytotoxic activity as anti cancer agents.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | IRRITANT, AIR SENSITIVE |
| HS Code | 29130000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |






