A6935212
1-Phenyl-1,2,3,4-tetrahydroisoquinoline , >98.0%(HPLC) , 22990-19-8
CAS NO.:22990-19-8
Empirical Formula: C15H15N
Molecular Weight: 209.29
MDL number: MFCD02179241
EINECS: 248-592-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB87.20 | In Stock |
|
| 25g | RMB294.40 | In Stock |
|
| 100g | RMB1084.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98.0 to 102.0 °C |
| Boiling point: | 338.4±11.0 °C(Predicted) |
| Density | 1.065±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.91±0.40(Predicted) |
| color | Off-White |
| λmax | 265nm(EtOH)(lit.) |
| InChI | InChI=1S/C15H15N/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15/h1-9,15-16H,10-11H2 |
| InChIKey | PRTRSEDVLBBFJZ-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)C2=C(C=CC=C2)CCN1 |
| CAS DataBase Reference | 22990-19-8(CAS DataBase Reference) |
Description and Uses
1-Phenyl-1,2,3,4-tetrahydroisoquinoline is a Solifenacin (S676700) intermediate. 1-Phenyl-1,2,3,4-tetrahydroisoquinoline had been detected in parkinsonian human brain. 1-Phenyl-1,2,3,4-tetrahydroisoquinoline maybe a candidate for endogenous MPTP-like neurotoxin since it is a structural analogue of MPTP which produces parkinsonism in humans.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301+H331-H314-H334-H227 |
| Precautionary statements | P501-P261-P270-P210-P271-P264-P280-P284-P370+P378-P342+P311-P303+P361+P353-P301+P330+P331-P363-P301+P310+P330-P304+P340+P310-P305+P351+P338+P310-P403+P233-P403+P235-P405 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| HS Code | 2933.49.7000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |









