A7416512
(<i>S</i>)-1-Phenyl-1,2,3,4-tetrahydroisoquinoline , >98.0% , 118864-75-8
CAS NO.：118864-75-8
Empirical Formula: C15H15N
Molecular Weight: 209.29
MDL number: MFCD08692036
EINECS: 1806241-263-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB88.00 | In Stock |
|
| 10g | RMB180.80 | In Stock |
|
| 25g | RMB294.40 | In Stock |
|
| 100g | RMB795.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-82°C |
| Boiling point: | 338°C |
| Density | 1.065 |
| Flash point: | 167°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 8.91±0.40(Predicted) |
| color | White to Off-White |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C15H15N/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15/h1-9,15-16H,10-11H2/t15-/m0/s1 |
| InChIKey | PRTRSEDVLBBFJZ-HNNXBMFYSA-N |
| SMILES | [C@H]1(C2=CC=CC=C2)C2=C(C=CC=C2)CCN1 |
| CAS DataBase Reference | 118864-75-8(CAS DataBase Reference) |
Description and Uses
(1S)-1-Phenyl-1,2,3,4-tetrahydroisoquinoline has been used as a lead compound for the development of drugs with dopamine β-hydroxylase inhibitory activity. In vitro studies have shown that 1-phenyl-1,2,3,4-tetrahydro-isoquinoline inhibits human serum dopamine β-hydroxylase and can be used to study the possible role of this enzyme in Parkinson's disease.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933.49.7000 |
