A6936212
Pyrazine-2,5-dicarboxylic acid , ≥97% , 122-05-4
CAS NO.：122-05-4
Empirical Formula: C6H4N2O4
Molecular Weight: 168.11
MDL number: MFCD01630902
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB31.20 | In Stock |
|
| 5G | RMB95.20 | In Stock |
|
| 25g | RMB367.20 | In Stock |
|
| 100g | RMB1239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 255-260℃ lit. |
| Boiling point: | 466.5±45.0 °C(Predicted) |
| Density | 1.665±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 2.20±0.10(Predicted) |
| form | Solid |
| Appearance | Light yellow to brown Solid |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C6H4N2O4/c9-5(10)3-1-7-4(2-8-3)6(11)12/h1-2H,(H,9,10)(H,11,12) |
| InChIKey | GMIOYJQLNFNGPR-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=NC=C(C(O)=O)N=C1 |
| CAS DataBase Reference | 122-05-4(CAS DataBase Reference) |
Description and Uses
It is an pyrazine used for proteomics research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2933998090 |
