A6950612
Propargyl-<I>N</I>-hydroxysuccinimidyl ester , 95% , 1174157-65-3
Synonym(s):
2,5-Dioxopyrrolidin-1-yl 3-(prop-2-ynyloxy)propanoate;3-(2-Propyn-1-yloxy)propanoic acid 2,5-dioxo-1-pyrrolidinyl ester;Alkyne-NHS ester;Propargyl-succinimidyl-ester
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB519.20 | In Stock |
|
| 250MG | RMB1951.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36-41°C |
| Boiling point: | 351.2±48.0 °C(Predicted) |
| Density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | Soluble in DMSO, DCM, DMF |
| form | Solid |
| color | Gray |
| Appearance | White solid |
| Water Solubility | Slightly soluble in water. |
| InChI | 1S/C10H11NO5/c1-2-6-15-7-5-10(14)16-11-8(12)3-4-9(11)13/h1H,3-7H2 |
| InChIKey | WKIKHHMUNOVQLD-UHFFFAOYSA-N |
| SMILES | C#CCOCCC(ON1C(CCC1=O)=O)=O |
Description and Uses
Propargyl-PEG1-NHS ester is an amine reactive reagent that can be used for derivatizing peptides, antibodies, amine coated surfaces etc. The alkyne group reacts with azide-bearing compounds or biomolecules in copper catalyzed Click Chemistry reactions.
N-Succinimidyl 3-(propargyloxy)propionate is an acetylene-containing reagent with NHS ester functionality for reaction with amines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| WGK Germany | 3 |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |







