A6956558
Anthraquinone-2-carboxylicAcid , 10mMinDMSO , 117-78-2
Synonym(s):
9,10-Dihydro-9,10-dioxo-2-anthracenecarboxylic acid
CAS NO.:117-78-2
Empirical Formula: C15H8O4
Molecular Weight: 252.22
MDL number: MFCD00001231
EINECS: 204-207-9
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 287-289 °C (lit.) |
| Boiling point: | 355.4°C (rough estimate) |
| Density | 1.469 |
| refractive index | 1.4872 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in hot Acetic acid(almost transparency). |
| form | powder to crystal |
| pka | pK1: 3.42 (20°C) |
| color | White to Amber |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C15H8O4/c16-13-9-3-1-2-4-10(9)14(17)12-7-8(15(18)19)5-6-11(12)13/h1-7H,(H,18,19) |
| InChIKey | ASDLSKCKYGVMAI-UHFFFAOYSA-N |
| SMILES | C1=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1C(O)=O |
| CAS DataBase Reference | 117-78-2(CAS DataBase Reference) |
Description and Uses
Anthraquinone 2-carboxylic acid (AQ) as a novel electron shuttling mediator and attached electron relay for HRP. Efficient method for the generation of hydrogen peroxide by aerobic photooxidation of 2-propanol using anthraquinone-2-carboxylic acid and molecular oxygen is investigated.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |





