A6958312
1-<WBR>Phenyl-<WBR>4,5-<WBR>dichloro-<WBR>6-<WBR>pyridazone , 99% , 1698-53-9
CAS NO.:1698-53-9
Empirical Formula: C10H6Cl2N2O
Molecular Weight: 241.07
MDL number: MFCD00006470
EINECS: 216-917-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB132.00 | In Stock |
|
| 5G | RMB407.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164-166 °C (lit.) |
| Boiling point: | 307.0±52.0 °C(Predicted) |
| Density | 1.4887 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | -3.44±0.60(Predicted) |
| form | Crystalline Powder |
| color | Light beige |
| InChI | 1S/C10H6Cl2N2O/c11-8-6-13-14(10(15)9(8)12)7-4-2-1-3-5-7/h1-6H |
| InChIKey | VKWCOHVAHQOJGU-UHFFFAOYSA-N |
| SMILES | ClC1=C(Cl)C(=O)N(N=C1)c2ccccc2 |
| CAS DataBase Reference | 1698-53-9(CAS DataBase Reference) |
Description and Uses
1-Phenyl-4,5-dichloro-6-pyridazone is part of a group of arylated pyridazin-3(2H)-one compounds that act as anti-cancer agents. 1-Phenyl-4,5-dichloro-6-pyridazone also has herbicidal activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 2 |
| RTECS | UR6200000 |
| Hazard Note | Irritant |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






