A6958812
2-Pyridylamidoxime , 97% , 1772-01-6
Synonym(s):
N-Hydroxypyridine-2-carboxamidine
| Pack Size | Price | Stock | Quantity |
| 1G | RMB57.60 | In Stock |
|
| 5G | RMB169.60 | In Stock |
|
| 25g | RMB606.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-124 °C (lit.) |
| Boiling point: | 278℃ |
| Density | 1.31 |
| refractive index | 1.6910 (estimate) |
| Flash point: | 122℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 20 mg/ml; PBS (pH 7.2): 1 mg/ml |
| form | powder to crystal |
| pka | 13.61±0.50(Predicted) |
| color | White to Light yellow |
| λmax | 277nm(H2O)(lit.) |
| InChI | InChI=1S/C6H7N3O/c7-6(9-10)5-3-1-2-4-8-5/h1-4,10H,(H2,7,9) |
| InChIKey | XKXCGXSHUNVFCT-UHFFFAOYSA-N |
| SMILES | C1(C(NO)=N)=NC=CC=C1 |
| CAS DataBase Reference | 1772-01-6 |
Description and Uses
2-Pyridylamide oxime is a synthetic intermediate useful for pharmaceutical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P280g |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | TJ4310000 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
