A6960658
2-Benzimidazolepropionicacid , 10mMinDMSO , 23249-97-0
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229-231 °C (dec.)(lit.) |
| Boiling point: | 497.9±28.0 °C(Predicted) |
| Density | 1.367±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMSO : ≥ 30 mg/mL (157.73 mM) |
| pka | 3.98±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| Merck | 13,7851 |
| InChI | InChI=1S/C10H10N2O2/c13-10(14)6-5-9-11-7-3-1-2-4-8(7)12-9/h1-4H,5-6H2,(H,11,12)(H,13,14) |
| InChIKey | XYWJNTOURDMTPI-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)NC2=CC=CC=C2N=1 |
| CAS DataBase Reference | 23249-97-0(CAS DataBase Reference) |
Description and Uses
immune stimulant
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | UE7480000 |
| HazardClass | IRRITANT |
| HS Code | 29332990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![ETHYL 4-CHLORO-5-METHYL-7-PHENYL-7H-PYRROLO[2,3-D]PYRIMIDINE-6-CARBOXYLATE](https://img.chemicalbook.com/CAS/GIF/245728-43-2.gif)

