A6963158
β-D-(+)-Glucosepentaacetate , 10mMinDMSO , 604-69-3
Synonym(s):
1,2,3,4,6-Penta-O-acetyl-β-D -glucopyranose;beta-D -Glucose pentaacetate
CAS NO.:604-69-3
Empirical Formula: C16H22O11
Molecular Weight: 390.34
MDL number: MFCD00006597
EINECS: 210-074-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130-132 °C |
| Boiling point: | 435.58°C (rough estimate) |
| alpha | 5 º (c=1, CHCl3) |
| Density | 1,274 g/cm3 |
| refractive index | 4.5 ° (C=5, CHCl3) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | chloroform: 0.1 g/mL, clear, colorless |
| form | Crystalline Powder |
| color | White to off-white |
| Odor | at 100.00%. odorless |
| optical activity | [α]20/D +4.2°, c = 1 in chloroform |
| Water Solubility | Soluble in chloroform and methanol. Insoluble in water. |
| BRN | 98851 |
| InChI | 1S/C16H22O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h12-16H,6H2,1-5H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | LPTITAGPBXDDGR-XJGFBQBWSA-N |
| SMILES | CC(O)O[C@@H]1[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| LogP | 0.634 (est) |
| CAS DataBase Reference | 604-69-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetyl 2,3,4,6-tetra-o-acetyl-«beta»-D-glucopyranoside(604-69-3) |
Description and Uses
β-D-Glucose Pentaacetate is used in biochemical reaction and also used as an active pharmaceutical intermediate. Further, it is used to stimulate insulin release in rat pancreatic islets.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 21-36/38-46-62-63 |
| Safety Statements | 24/25-53-36/37-26-25 |
| WGK Germany | 3 |
| HS Code | 29400090 |
| Storage Class | 11 - Combustible Solids |





