A6975858
Droxidopa , 2mMinDMSO , 23651-95-8
Synonym(s):
Droxidopa;L-threo 3,4-Dihydroxyphenylserine
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232-235° (dec); mp 229-232° (dec) (Ohashi) |
| alpha | D20 -39° (c = 1 in 1N aq HCl); D20 -42.0° (c = 1 in 1N aq HCl) |
| Boiling point: | 549.8±50.0 °C(Predicted) |
| Density | 1.608±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO: ≥3mg/mL |
| pka | 2.09±0.24(Predicted) |
| form | powder |
| color | white to tan |
| Merck | 14,3457 |
| Stability: | Hygroscopic |
| InChI | InChI=1/C9H11NO5/c10-7(9(14)15)8(13)4-1-2-5(11)6(12)3-4/h1-3,7-8,11-13H,10H2,(H,14,15)/t7-,8+/s3 |
| InChIKey | QXWYKJLNLSIPIN-WWXSATIUNA-N |
| SMILES | [C@H](C1C=CC(O)=C(O)C=1)(O)[C@H](N)C(=O)O |&1:0,10,r| |
| CAS DataBase Reference | 23651-95-8 |
Description and Uses
Droxidopa is a synthetic amino acid precursor of (-)-norepinephrine which is absorbed from the gut and metabolized to norepinephrine. In Parkinsonian patients, droxidopa added to existing levodopa/decarboxylase inhibitor therapy produces significant improvements in retropulsion, dysarthria and muscular rigidity refractory to other treatments; however, tremor was unaffected.
Droxidopa is a psychoactive drug and acts as a prodrug to the neurotransmitters norepinephrine (noradrenaline) and epinephrine (adrenaline).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | VT9626010 |
| HS Code | 29225090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






