A6976112
Procainamide hydrochloride , 98% , 614-39-1
Synonym(s):
Procainamide hydrochloride;Pronestyl;Pronestyl hydrochloride;Spicain amide;Procainamide monohydrochloride
CAS NO.:614-39-1
Empirical Formula: C13H22ClN3O
Molecular Weight: 271.79
MDL number: MFCD00012998
EINECS: 210-381-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB66.40 | In Stock |
|
| 25G | RMB169.60 | In Stock |
|
| 100G | RMB516.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165-168 °C |
| Density | 1.2027 (rough estimate) |
| refractive index | 1.6330 (estimate) |
| storage temp. | 2-8°C |
| solubility | H2O: soluble1g/10 mL, clear, greenish-yellow |
| form | Powder |
| color | White to slightly yellow |
| Water Solubility | soluble |
| Sensitive | Light Sensitive/Air Sensitive |
| Merck | 13,7845 |
| BRN | 3729517 |
| InChI | InChI=1S/C13H21N3O.ClH/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(14)8-6-11;/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17);1H |
| InChIKey | ABTXGJFUQRCPNH-UHFFFAOYSA-N |
| SMILES | C1(=CC=C(N)C=C1)C(=O)NCCN(CC)CC.Cl |
| CAS DataBase Reference | 614-39-1(CAS DataBase Reference) |
| EPA Substance Registry System | Benzamide, 4-amino-N-[2-(diethylamino)ethyl]-, monohydrochloride (614-39-1) |
Description and Uses
Procainamide hydrochloride (PAH) is suitable to investigate its binding behavior with human serum albumin and bovine serum albumin by fluorescence quenching study to understand the pharmacokinetic and pharmacodynamic mechanisms of PAH.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | CV2295000 |
| TSCA | TSCA listed |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





