PRODUCT Properties
| Melting point: | 164-170 °C(lit.) | 
                                    
| Boiling point: | 234.22°C (rough estimate) | 
                                    
| Density | 1.3659 (rough estimate) | 
                                    
| refractive index | 1.8500 (estimate) | 
                                    
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature | 
                                    
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | 
                                    
| pka | 11.97±0.10(Predicted) | 
                                    
| form | Powder | 
                                    
| color | White | 
                                    
| Water Solubility | Soluble in DMSO, Methanol, Water. | 
                                    
| InChI | InChI=1S/C4H6N4O/c5-3-2(4(6)9)7-1-8-3/h1H,5H2,(H2,6,9)(H,7,8) | 
                                    
| InChIKey | DVNYTAVYBRSTGK-UHFFFAOYSA-N | 
                                    
| SMILES | C1NC(N)=C(C(N)=O)N=1 | 
                                    
| CAS DataBase Reference | 360-97-4(CAS DataBase Reference) | 
                                    
| EPA Substance Registry System | 1H-Imidazole-4-carboxamide, 5-amino- (360-97-4) | 
                                    
Description and Uses
5-Amino-4-imidazolecarboxamide may be used in the synthesis of 4-(N′-benzoylcarbamoyl)amino-5-imidazolecarboxamide and 5-amino-1-β-D-ribosyl-4-imidazolecarboxamide-5′-phosphate (AICAR).
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36 | 
| RIDADR | UN2811 | 
| WGK Germany | 3 | 
| RTECS | NI3910000 | 
| TSCA | Yes | 
| HazardClass | 6.1 | 
| HS Code | 29332900 | 
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) | 
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | 







![3-Methyl-4-oxo-3,4-dihydroimidazo[5,1-d][1,2,3,5]tetrazine-8-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/113942-30-6.gif)