PRODUCT Properties
| Melting point: | 156-157° |
| Boiling point: | 355.44°C (rough estimate) |
| Density | 1.1824 (rough estimate) |
| refractive index | 1.5600 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly) |
| form | Solid |
| pka | pKa 4.13(H2O t=25.0±0.1 I=0.1(NaCl)) (Uncertain) |
| color | White to Off-White |
| InChI | InChI=1S/C16H12O3/c1-19-11-8-6-10(7-9-11)14-15(17)12-4-2-3-5-13(12)16(14)18/h2-9,14H,1H3 |
| InChIKey | XRCFXMGQEVUZFC-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)C1C1=CC=C(OC)C=C1 |
| EPA Substance Registry System | Anisindione (117-37-3) |
Description and Uses
radiopaque agent
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H351 |
| Precautionary statements | P264-P270-P308+P313-P301+P312+P330-P501 |
| RIDADR | 2811 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Hazardous Substances Data | 117-37-3(Hazardous Substances Data) |
| Toxicity | mouse,LD50,intraperitoneal,200mg/kg (200mg/kg),Journal of Medicinal Chemistry. Vol. 28, Pg. 1591, 1985. |
