A6991758
AlisolBAcetate , 10mMinDMSO , 26575-95-1
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB370.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162～163℃ |
| Boiling point: | 590.7±50.0 °C(Predicted) |
| Density | 1.12±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 14.74±0.70(Predicted) |
| color | White |
| InChIKey | NLOAQXKIIGTTRE-CAMIZLLSNA-N |
| SMILES | C[C@]12CC[C@@]3([H])C(C(=O)CC[C@]3(C)[C@]1([H])[C@H](CC1=C([C@H](C)C[C@@H]([C@@]3([H])OC3(C)C)OC(=O)C)CC[C@]21C)O)(C)C |&1:1,4,11,13,15,19,22,23,35,r| |
Description and Uses
Alisol B 23-Acetate is effective in reversing the multi-drug resistance of specific over-expressing P-glycoprotein cancer cells. An herbal triterpene extract that is useful in the treatment of cancers, primarily prostate cancer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 24/25 |
| HS Code | 29153900 |
